C16H20N2O4 — CID 146518003
2-(2-hydroxy-6-oxopiperidin-3-yl)-5-propan-2-yloxy-3H-isoindol-1-one (PubChem CID 146518003) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(2-hydroxy-6-oxopiperidin-3-yl)-5-propan-2-yloxy-3H-isoindol-1-one.
| Compound Name | 2-(2-hydroxy-6-oxopiperidin-3-yl)-5-propan-2-yloxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 146518003 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-(2-hydroxy-6-oxopiperidin-3-yl)-5-propan-2-yloxy-3H-isoindol-1-one |
| SMILES | CC(C)Oc1ccc2c(c1)CN(C1CCC(=O)NC1O)C2=O |
| InChI | InChI=1S/C16H20N2O4/c1-9(2)22-11-3-4-12-10(7-11)8-18(16(12)21)13-5-6-14(19)17-15(13)20/h3-4,7,9,13,15,20H,5-6,8H2,1-2H3,(H,17,19) |
| InChIKey | KYBLQVBXTAIFJV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |