C57H38N4 — CID 156528933
2-(9,9-diphenylfluoren-2-yl)-4-[4-(2,6-diphenyl-3-pyridinyl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 156528933) has the molecular formula C57H38N4 and a molecular weight of 778.96 g/mol. Its IUPAC name is 2-(9,9-diphenylfluoren-2-yl)-4-[4-(2,6-diphenyl-3-pyridinyl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-diphenylfluoren-2-yl)-4-[4-(2,6-diphenyl-3-pyridinyl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 156528933 |
| Molecular Formula | C57H38N4 |
| Molecular Weight | 778.96 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | 2-(9,9-diphenylfluoren-2-yl)-4-[4-(2,6-diphenyl-3-pyridinyl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc6c(c5)C(c5ccccc5)(c5ccccc5)c5ccccc5-6)n4)cc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C57H38N4/c1-6-18-40(19-7-1)52-37-36-47(53(58-52)41-20-8-2-9-21-41)39-30-32-43(33-31-39)55-59-54(42-22-10-3-11-23-42)60-56(61-55)44-34-35-49-48-28-16-17-29-50(48)57(51(49)38-44,45-24-12-4-13-25-45)46-26-14-5-15-27-46/h1-38H |
| InChIKey | PZBFUKZWTXCVRU-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.96 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |