C80H74N4 — CID 156529590
1-N,6-N-bis[9-(3,5-ditert-butylphenyl)carbazol-4-yl]-1-N,6-N-diphenylpyrene-1,6-diamine (PubChem CID 156529590) has the molecular formula C80H74N4 and a molecular weight of 1091.50 g/mol. Its IUPAC name is 1-N,6-N-bis[9-(3,5-ditert-butylphenyl)carbazol-4-yl]-1-N,6-N-diphenylpyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[9-(3,5-ditert-butylphenyl)carbazol-4-yl]-1-N,6-N-diphenylpyrene-1,6-diamine |
|---|---|
| PubChem CID | 156529590 |
| Molecular Formula | C80H74N4 |
| Molecular Weight | 1091.50 g/mol |
| Exact Mass | 1090.59 |
| IUPAC Name | 1-N,6-N-bis[9-(3,5-ditert-butylphenyl)carbazol-4-yl]-1-N,6-N-diphenylpyrene-1,6-diamine |
| SMILES | CC(C)(C)c1cc(-n2c3ccccc3c3c(N(c4ccccc4)c4ccc5ccc6c(N(c7ccccc7)c7cccc8c7c7ccccc7n8-c7cc(C(C)(C)C)cc(C(C)(C)C)c7)ccc7ccc4c5c76)cccc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C80H74N4/c1-77(2,3)53-45-54(78(4,5)6)48-59(47-53)83-65-31-21-19-29-61(65)75-69(33-23-35-71(75)83)81(57-25-15-13-16-26-57)67-43-39-51-38-42-64-68(44-40-52-37-41-63(67)73(51)74(52)64)82(58-27-17-14-18-28-58)70-34-24-36-72-76(70)62-30-20-22-32-66(62)84(72)60-49-55(79(7,8)9)46-56(50-60)80(10,11)12/h13-50H,1-12H3 |
| InChIKey | ACJINXFWTGWQKZ-UHFFFAOYSA-N |
| XLogP | 22.91 |
| TPSA | 16.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.50 |
| LogP ≤ 5 | 22.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|