C20H24O2 — CID 156531437
(10R,13R,16S)-16-hydroxy-4,10,13-trimethyl-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-3-one (PubChem CID 156531437) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (10R,13R,16S)-16-hydroxy-4,10,13-trimethyl-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13R,16S)-16-hydroxy-4,10,13-trimethyl-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 156531437 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (10R,13R,16S)-16-hydroxy-4,10,13-trimethyl-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1=C2CCC3=C(CC[C@]4(C)C[C@H](O)C=C34)[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C20H24O2/c1-12-15-5-4-14-16(20(15,3)9-7-18(12)22)6-8-19(2)11-13(21)10-17(14)19/h7,9-10,13,21H,4-6,8,11H2,1-3H3/t13-,19-,20+/m1/s1 |
| InChIKey | MDPVGHWNTUOHPK-GBLZOACLSA-N |
| XLogP | 4.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |