C28H40O2 — CID 164675356
(10R,13S,16S,17S)-16-hydroxy-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-3-one (PubChem CID 164675356) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is (10R,13S,16S,17S)-16-hydroxy-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S,16S,17S)-16-hydroxy-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 164675356 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | (10R,13S,16S,17S)-16-hydroxy-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1=C2CCC3=C(CC[C@]4(C)C3=C[C@H](O)[C@H]4[C@H](C)CCCC(C)C)[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C28H40O2/c1-17(2)8-7-9-18(3)26-25(30)16-23-20-10-11-21-19(4)24(29)13-15-27(21,5)22(20)12-14-28(23,26)6/h13,15-18,25-26,30H,7-12,14H2,1-6H3/t18-,25+,26-,27+,28-/m1/s1 |
| InChIKey | CNXCYCZABILGSU-JHMMWVIGSA-N |
| XLogP | 6.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |