C24H25BrOS — CID 156533758
2-bromo-9-methylsulfanyl-7,7-dipropylbenzo[c]fluoren-5-ol (PubChem CID 156533758) has the molecular formula C24H25BrOS and a molecular weight of 441.43 g/mol. Its IUPAC name is 2-bromo-9-methylsulfanyl-7,7-dipropylbenzo[c]fluoren-5-ol.
| Compound Name | 2-bromo-9-methylsulfanyl-7,7-dipropylbenzo[c]fluoren-5-ol |
|---|---|
| PubChem CID | 156533758 |
| Molecular Formula | C24H25BrOS |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-bromo-9-methylsulfanyl-7,7-dipropylbenzo[c]fluoren-5-ol |
| SMILES | CCCC1(CCC)c2cc(SC)ccc2-c2c1cc(O)c1ccc(Br)cc21 |
| InChI | InChI=1S/C24H25BrOS/c1-4-10-24(11-5-2)20-13-16(27-3)7-9-18(20)23-19-12-15(25)6-8-17(19)22(26)14-21(23)24/h6-9,12-14,26H,4-5,10-11H2,1-3H3 |
| InChIKey | LOFZISDXCXDNAE-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |