C20H20BrN — CID 140702286
2-bromo-7-isocyano-9,9-dipropylfluorene (PubChem CID 140702286) has the molecular formula C20H20BrN and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-bromo-7-isocyano-9,9-dipropylfluorene.
| Compound Name | 2-bromo-7-isocyano-9,9-dipropylfluorene |
|---|---|
| PubChem CID | 140702286 |
| Molecular Formula | C20H20BrN |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-bromo-7-isocyano-9,9-dipropylfluorene |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(CCC)(CCC)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C20H20BrN/c1-4-10-20(11-5-2)18-12-14(21)6-8-16(18)17-9-7-15(22-3)13-19(17)20/h6-9,12-13H,4-5,10-11H2,1-2H3 |
| InChIKey | DRDVPQOCECVPCK-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|