C40H34N2 — CID 140702285
4-[2-(7-isocyano-9,9-dipropylfluoren-2-yl)ethynyl]-N,N-diphenylaniline (PubChem CID 140702285) has the molecular formula C40H34N2 and a molecular weight of 542.73 g/mol. Its IUPAC name is 4-[2-(7-isocyano-9,9-dipropylfluoren-2-yl)ethynyl]-N,N-diphenylaniline.
| Compound Name | 4-[2-(7-isocyano-9,9-dipropylfluoren-2-yl)ethynyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 140702285 |
| Molecular Formula | C40H34N2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 4-[2-(7-isocyano-9,9-dipropylfluoren-2-yl)ethynyl]-N,N-diphenylaniline |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(CCC)(CCC)c1cc(C#Cc3ccc(N(c4ccccc4)c4ccccc4)cc3)ccc1-2 |
| InChI | InChI=1S/C40H34N2/c1-4-26-40(27-5-2)38-28-31(20-24-36(38)37-25-21-32(41-3)29-39(37)40)17-16-30-18-22-35(23-19-30)42(33-12-8-6-9-13-33)34-14-10-7-11-15-34/h6-15,18-25,28-29H,4-5,26-27H2,1-2H3 |
| InChIKey | LPDYPHYAQHLMNB-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|