C49H42AuNP+ — CID 168830141
9,9-diethyl-7-ethynyl-N,N-diphenylfluoren-2-amine;gold(1+);triphenylphosphanium (PubChem CID 168830141) has the molecular formula C49H42AuNP+ and a molecular weight of 872.82 g/mol. Its IUPAC name is 9,9-diethyl-7-ethynyl-N,N-diphenylfluoren-2-amine;gold(1+);triphenylphosphanium.
| Compound Name | 9,9-diethyl-7-ethynyl-N,N-diphenylfluoren-2-amine;gold(1+);triphenylphosphanium |
|---|---|
| PubChem CID | 168830141 |
| Molecular Formula | C49H42AuNP+ |
| Molecular Weight | 872.82 g/mol |
| Exact Mass | 872.27 |
| IUPAC Name | 9,9-diethyl-7-ethynyl-N,N-diphenylfluoren-2-amine;gold(1+);triphenylphosphanium |
| SMILES | [Au+].[C-]#Cc1ccc2c(c1)C(CC)(CC)c1cc(N(c3ccccc3)c3ccccc3)ccc1-2.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N.C18H15P.Au/c1-4-23-17-19-27-28-20-18-26(22-30(28)31(5-2,6-3)29(27)21-23)32(24-13-9-7-10-14-24)25-15-11-8-12-16-25;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h7-22H,5-6H2,2-3H3;1-15H;/q-1;;+1/p+1 |
| InChIKey | ALUOVXNOFFTGST-UHFFFAOYSA-O |
| XLogP | 11.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.82 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|