C12H15FN4O3 — CID 156534176
[1-[(3-fluoro-2-pyridinyl)carbamoyl]piperidin-4-yl]carbamic acid (PubChem CID 156534176) has the molecular formula C12H15FN4O3 and a molecular weight of 282.27 g/mol. Its IUPAC name is [1-[(3-fluoro-2-pyridinyl)carbamoyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[(3-fluoro-2-pyridinyl)carbamoyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 156534176 |
| Molecular Formula | C12H15FN4O3 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [1-[(3-fluoro-2-pyridinyl)carbamoyl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(C(=O)Nc2ncccc2F)CC1 |
| InChI | InChI=1S/C12H15FN4O3/c13-9-2-1-5-14-10(9)16-11(18)17-6-3-8(4-7-17)15-12(19)20/h1-2,5,8,15H,3-4,6-7H2,(H,19,20)(H,14,16,18) |
| InChIKey | ARKSTHSVJWQQDC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |