C17H20N4O2S — CID 47849739
N-(3-methyl-2-pyridinyl)-4-(thiophene-2-carbonylamino)piperidine-1-carboxamide (PubChem CID 47849739) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-(3-methyl-2-pyridinyl)-4-(thiophene-2-carbonylamino)piperidine-1-carboxamide.
| Compound Name | N-(3-methyl-2-pyridinyl)-4-(thiophene-2-carbonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 47849739 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-(3-methyl-2-pyridinyl)-4-(thiophene-2-carbonylamino)piperidine-1-carboxamide |
| SMILES | Cc1cccnc1NC(=O)N1CCC(NC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H20N4O2S/c1-12-4-2-8-18-15(12)20-17(23)21-9-6-13(7-10-21)19-16(22)14-5-3-11-24-14/h2-5,8,11,13H,6-7,9-10H2,1H3,(H,19,22)(H,18,20,23) |
| InChIKey | HNMOLIUPCRONRP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |