About benzyl 6-phosphonooxyhexanoate
benzyl 6-phosphonooxyhexanoate (PubChem CID 156534469) has the molecular formula C13H19O6P
and a molecular weight of 302.26 g/mol. Its IUPAC name is benzyl 6-phosphonooxyhexanoate.
Molecular Properties
| Compound Name | benzyl 6-phosphonooxyhexanoate |
| PubChem CID | 156534469 |
| Molecular Formula | C13H19O6P |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | benzyl 6-phosphonooxyhexanoate |
| SMILES | O=C(CCCCCOP(=O)(O)O)OCc1ccccc1 |
| InChI | InChI=1S/C13H19O6P/c14-13(18-11-12-7-3-1-4-8-12)9-5-2-6-10-19-20(15,16)17/h1,3-4,7-8H,2,5-6,9-11H2,(H2,15,16,17) |
| InChIKey | WQWVVSMYKMEADD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl 6-phosphonooxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 6-phosphonooxyhexanoate?
The IUPAC name of benzyl 6-phosphonooxyhexanoate (CID 156534469) is benzyl 6-phosphonooxyhexanoate.
What is the SMILES notation for benzyl 6-phosphonooxyhexanoate?
The canonical SMILES for benzyl 6-phosphonooxyhexanoate is O=C(CCCCCOP(=O)(O)O)OCc1ccccc1.
What is the InChIKey of benzyl 6-phosphonooxyhexanoate?
The InChIKey is WQWVVSMYKMEADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19O6P/c14-13(18-11-12-7-3-1-4-8-12)9-5-2-6-10-19-20(15,16)17/h1,3-4,7-8H,2,5-6,9-11H2,(H2,15,16,17).
What are the key properties of benzyl 6-phosphonooxyhexanoate?
benzyl 6-phosphonooxyhexanoate has a molecular weight of 302.26 g/mol, XLogP of 2.40, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 6-phosphonooxyhexanoate is sourced from PubChem (CID 156534469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).