C18H20N2O6 — CID 156535665
5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-hydroxypentanoic acid (PubChem CID 156535665) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-hydroxypentanoic acid.
| Compound Name | 5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 156535665 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-hydroxypentanoic acid |
| SMILES | O=C1CCC(N2Cc3c(CCCC(O)C(=O)O)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H20N2O6/c21-14(18(25)26)6-2-4-10-3-1-5-11-12(10)9-20(17(11)24)13-7-8-15(22)19-16(13)23/h1,3,5,13-14,21H,2,4,6-9H2,(H,25,26)(H,19,22,23) |
| InChIKey | VPYXNMWNJNZRAM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|