C16H12N6O2 — CID 156536720
N-methyl-8-nitro-N-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine (PubChem CID 156536720) has the molecular formula C16H12N6O2 and a molecular weight of 320.31 g/mol. Its IUPAC name is N-methyl-8-nitro-N-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine.
| Compound Name | N-methyl-8-nitro-N-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 156536720 |
| Molecular Formula | C16H12N6O2 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-methyl-8-nitro-N-phenyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
| SMILES | CN(c1ccccc1)c1nc2nncn2c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C16H12N6O2/c1-20(11-5-3-2-4-6-11)15-13-8-7-12(22(23)24)9-14(13)21-10-17-19-16(21)18-15/h2-10H,1H3 |
| InChIKey | FMWPUECZKDGBHX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|