C9H5N5O3 — CID 156536273
8-nitro-4H-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 156536273) has the molecular formula C9H5N5O3 and a molecular weight of 231.17 g/mol. Its IUPAC name is 8-nitro-4H-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 8-nitro-4H-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 156536273 |
| Molecular Formula | C9H5N5O3 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 8-nitro-4H-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | O=c1[nH]c2nncn2c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C9H5N5O3/c15-8-6-2-1-5(14(16)17)3-7(6)13-4-10-12-9(13)11-8/h1-4H,(H,11,12,15) |
| InChIKey | NWNASQCYFXXHGV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|