C17H8N4O4 — CID 10860531
10-nitro-5,12-dioxo-6H-isoquinolino[2,3-a]quinazoline-7-carbonitrile (PubChem CID 10860531) has the molecular formula C17H8N4O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is 10-nitro-5,12-dioxo-6H-isoquinolino[2,3-a]quinazoline-7-carbonitrile.
| Compound Name | 10-nitro-5,12-dioxo-6H-isoquinolino[2,3-a]quinazoline-7-carbonitrile |
|---|---|
| PubChem CID | 10860531 |
| Molecular Formula | C17H8N4O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 10-nitro-5,12-dioxo-6H-isoquinolino[2,3-a]quinazoline-7-carbonitrile |
| SMILES | N#Cc1c2ccc([N+](=O)[O-])cc2c(=O)n2c1[nH]c(=O)c1ccccc12 |
| InChI | InChI=1S/C17H8N4O4/c18-8-13-10-6-5-9(21(24)25)7-12(10)17(23)20-14-4-2-1-3-11(14)16(22)19-15(13)20/h1-7H,(H,19,22) |
| InChIKey | OEIKRJGVUQUHDX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|