About 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate
1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate (PubChem CID 170412015) has the molecular formula C15H6F2N3O4-
and a molecular weight of 330.23 g/mol. Its IUPAC name is 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate.
Molecular Properties
| Compound Name | 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate |
| PubChem CID | 170412015 |
| Molecular Formula | C15H6F2N3O4- |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate |
| SMILES | O=c1c2c(F)cc(F)cc2[nH]c2c([O-])c3cc([N+](=O)[O-])ccc3n12 |
| InChI | InChI=1S/C15H7F2N3O4/c16-6-3-9(17)12-10(4-6)18-14-13(21)8-5-7(20(23)24)1-2-11(8)19(14)15(12)22/h1-5,18,21H/p-1 |
| InChIKey | VSHSDIQEYRRFLV-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate?
The IUPAC name of 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate (CID 170412015) is 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate.
What is the SMILES notation for 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate?
The canonical SMILES for 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate is O=c1c2c(F)cc(F)cc2[nH]c2c([O-])c3cc([N+](=O)[O-])ccc3n12.
What is the InChIKey of 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate?
The InChIKey is VSHSDIQEYRRFLV-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H7F2N3O4/c16-6-3-9(17)12-10(4-6)18-14-13(21)8-5-7(20(23)24)1-2-11(8)19(14)15(12)22/h1-5,18,21H/p-1.
What are the key properties of 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate?
1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate has a molecular weight of 330.23 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-8-nitro-12-oxo-5H-indolo[2,1-b]quinazolin-6-olate is sourced from PubChem (CID 170412015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).