C20H12N4O3 — CID 176508336
6-(1H-indol-3-yl)-4-(3-nitrophenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 176508336) has the molecular formula C20H12N4O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 6-(1H-indol-3-yl)-4-(3-nitrophenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-(1H-indol-3-yl)-4-(3-nitrophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 176508336 |
| Molecular Formula | C20H12N4O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 6-(1H-indol-3-yl)-4-(3-nitrophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccc([N+](=O)[O-])c2)cc(-c2c[nH]c3ccccc23)[nH]c1=O |
| InChI | InChI=1S/C20H12N4O3/c21-10-16-15(12-4-3-5-13(8-12)24(26)27)9-19(23-20(16)25)17-11-22-18-7-2-1-6-14(17)18/h1-9,11,22H,(H,23,25) |
| InChIKey | HVMWVSARUIALOL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|