C22H25NO3 — CID 156537068
[3-(3-hydroxyoxetan-3-yl)phenyl]-[4-(4-methylphenyl)piperidin-1-yl]methanone (PubChem CID 156537068) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [3-(3-hydroxyoxetan-3-yl)phenyl]-[4-(4-methylphenyl)piperidin-1-yl]methanone.
| Compound Name | [3-(3-hydroxyoxetan-3-yl)phenyl]-[4-(4-methylphenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 156537068 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [3-(3-hydroxyoxetan-3-yl)phenyl]-[4-(4-methylphenyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(C2CCN(C(=O)c3cccc(C4(O)COC4)c3)CC2)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-16-5-7-17(8-6-16)18-9-11-23(12-10-18)21(24)19-3-2-4-20(13-19)22(25)14-26-15-22/h2-8,13,18,25H,9-12,14-15H2,1H3 |
| InChIKey | ZCMGZWRRFCJKNX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |