C27H27NO3 — CID 71211978
1-[4-[1-[3-(4-methylphenoxy)benzoyl]piperidin-4-yl]phenyl]ethanone (PubChem CID 71211978) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[4-[1-[3-(4-methylphenoxy)benzoyl]piperidin-4-yl]phenyl]ethanone.
| Compound Name | 1-[4-[1-[3-(4-methylphenoxy)benzoyl]piperidin-4-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 71211978 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-[4-[1-[3-(4-methylphenoxy)benzoyl]piperidin-4-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C2CCN(C(=O)c3cccc(Oc4ccc(C)cc4)c3)CC2)cc1 |
| InChI | InChI=1S/C27H27NO3/c1-19-6-12-25(13-7-19)31-26-5-3-4-24(18-26)27(30)28-16-14-23(15-17-28)22-10-8-21(9-11-22)20(2)29/h3-13,18,23H,14-17H2,1-2H3 |
| InChIKey | YBJBOOFBZWCNJV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |