C18H19BBrNO3 — CID 166406859
[3-[4-(4-bromophenyl)piperidine-1-carbonyl]phenyl]boronic acid (PubChem CID 166406859) has the molecular formula C18H19BBrNO3 and a molecular weight of 388.07 g/mol. Its IUPAC name is [3-[4-(4-bromophenyl)piperidine-1-carbonyl]phenyl]boronic acid.
| Compound Name | [3-[4-(4-bromophenyl)piperidine-1-carbonyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 166406859 |
| Molecular Formula | C18H19BBrNO3 |
| Molecular Weight | 388.07 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | [3-[4-(4-bromophenyl)piperidine-1-carbonyl]phenyl]boronic acid |
| SMILES | O=C(c1cccc(B(O)O)c1)N1CCC(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H19BBrNO3/c20-17-6-4-13(5-7-17)14-8-10-21(11-9-14)18(22)15-2-1-3-16(12-15)19(23)24/h1-7,12,14,23-24H,8-11H2 |
| InChIKey | YKMCRJCRUOMLCU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.07 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|