C18H25F5N2O3 — CID 156537617
tert-butyl 2-[[3-(7,7,8,8,8-pentafluorooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate (PubChem CID 156537617) has the molecular formula C18H25F5N2O3 and a molecular weight of 412.40 g/mol. Its IUPAC name is tert-butyl 2-[[3-(7,7,8,8,8-pentafluorooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[[3-(7,7,8,8,8-pentafluorooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 156537617 |
| Molecular Formula | C18H25F5N2O3 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | tert-butyl 2-[[3-(7,7,8,8,8-pentafluorooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
| SMILES | C=C(Cc1nc(CCCCCCC(F)(F)C(F)(F)F)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25F5N2O3/c1-12(15(26)27-16(2,3)4)11-14-24-13(25-28-14)9-7-5-6-8-10-17(19,20)18(21,22)23/h1,5-11H2,2-4H3 |
| InChIKey | FBXUBRZUBHJTQK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|