C18H28F2N2O3 — CID 156537691
tert-butyl 2-[[3-(8,8-difluorooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate (PubChem CID 156537691) has the molecular formula C18H28F2N2O3 and a molecular weight of 358.43 g/mol. Its IUPAC name is tert-butyl 2-[[3-(8,8-difluorooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[[3-(8,8-difluorooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 156537691 |
| Molecular Formula | C18H28F2N2O3 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | tert-butyl 2-[[3-(8,8-difluorooctyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
| SMILES | C=C(Cc1nc(CCCCCCCC(F)F)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28F2N2O3/c1-13(17(23)24-18(2,3)4)12-16-21-15(22-25-16)11-9-7-5-6-8-10-14(19)20/h14H,1,5-12H2,2-4H3 |
| InChIKey | JNZPOCLVVIFTCA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|