C19H19N3O4 — CID 156537891
ethyl (2S)-3-(4-aminophenyl)-2-[(1,3-dioxoisoindol-2-yl)amino]propanoate (PubChem CID 156537891) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is ethyl (2S)-3-(4-aminophenyl)-2-[(1,3-dioxoisoindol-2-yl)amino]propanoate.
| Compound Name | ethyl (2S)-3-(4-aminophenyl)-2-[(1,3-dioxoisoindol-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 156537891 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | ethyl (2S)-3-(4-aminophenyl)-2-[(1,3-dioxoisoindol-2-yl)amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(N)cc1)NN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H19N3O4/c1-2-26-19(25)16(11-12-7-9-13(20)10-8-12)21-22-17(23)14-5-3-4-6-15(14)18(22)24/h3-10,16,21H,2,11,20H2,1H3/t16-/m0/s1 |
| InChIKey | FURFIIGRGATTJX-INIZCTEOSA-N |
| XLogP | 1.54 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|