C12H18FN7O — CID 156538324
2-[(3S,4R)-4-(2-azidoethoxy)-3-fluoro-3-methylpiperidin-1-yl]pyrimidin-4-amine (PubChem CID 156538324) has the molecular formula C12H18FN7O and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[(3S,4R)-4-(2-azidoethoxy)-3-fluoro-3-methylpiperidin-1-yl]pyrimidin-4-amine.
| Compound Name | 2-[(3S,4R)-4-(2-azidoethoxy)-3-fluoro-3-methylpiperidin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156538324 |
| Molecular Formula | C12H18FN7O |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-[(3S,4R)-4-(2-azidoethoxy)-3-fluoro-3-methylpiperidin-1-yl]pyrimidin-4-amine |
| SMILES | C[C@]1(F)CN(c2nccc(N)n2)CC[C@H]1OCCN=[N+]=[N-] |
| InChI | InChI=1S/C12H18FN7O/c1-12(13)8-20(11-16-4-2-10(14)18-11)6-3-9(12)21-7-5-17-19-15/h2,4,9H,3,5-8H2,1H3,(H2,14,16,18)/t9-,12+/m1/s1 |
| InChIKey | ROVGXNBKMGJBBF-SKDRFNHKSA-N |
| XLogP | 1.69 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|