C22H25N5S — CID 156539085
4-[3-[[1-(7-methylthieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl]amino]propyl]benzonitrile (PubChem CID 156539085) has the molecular formula C22H25N5S and a molecular weight of 391.54 g/mol. Its IUPAC name is 4-[3-[[1-(7-methylthieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl]amino]propyl]benzonitrile.
| Compound Name | 4-[3-[[1-(7-methylthieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl]amino]propyl]benzonitrile |
|---|---|
| PubChem CID | 156539085 |
| Molecular Formula | C22H25N5S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 4-[3-[[1-(7-methylthieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl]amino]propyl]benzonitrile |
| SMILES | Cc1csc2c(N3CCC(NCCCc4ccc(C#N)cc4)CC3)ncnc12 |
| InChI | InChI=1S/C22H25N5S/c1-16-14-28-21-20(16)25-15-26-22(21)27-11-8-19(9-12-27)24-10-2-3-17-4-6-18(13-23)7-5-17/h4-7,14-15,19,24H,2-3,8-12H2,1H3 |
| InChIKey | XMERCMRMSGGDRU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|