C20H24ClN5S — CID 156539124
1-(2-chloro-7-methylthieno[3,2-d]pyrimidin-4-yl)-N-(3-pyridin-4-ylpropyl)piperidin-4-amine (PubChem CID 156539124) has the molecular formula C20H24ClN5S and a molecular weight of 401.97 g/mol. Its IUPAC name is 1-(2-chloro-7-methylthieno[3,2-d]pyrimidin-4-yl)-N-(3-pyridin-4-ylpropyl)piperidin-4-amine.
| Compound Name | 1-(2-chloro-7-methylthieno[3,2-d]pyrimidin-4-yl)-N-(3-pyridin-4-ylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 156539124 |
| Molecular Formula | C20H24ClN5S |
| Molecular Weight | 401.97 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-(2-chloro-7-methylthieno[3,2-d]pyrimidin-4-yl)-N-(3-pyridin-4-ylpropyl)piperidin-4-amine |
| SMILES | Cc1csc2c(N3CCC(NCCCc4ccncc4)CC3)nc(Cl)nc12 |
| InChI | InChI=1S/C20H24ClN5S/c1-14-13-27-18-17(14)24-20(21)25-19(18)26-11-6-16(7-12-26)23-8-2-3-15-4-9-22-10-5-15/h4-5,9-10,13,16,23H,2-3,6-8,11-12H2,1H3 |
| InChIKey | QYQVQQDPXSWSDX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.97 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|