C21H25ClN4S2 — CID 175315760
N-[3-(3-chlorophenyl)propyl]-1-(7-methylsulfanylthieno[3,2-d]pyrimidin-4-yl)piperidin-4-amine (PubChem CID 175315760) has the molecular formula C21H25ClN4S2 and a molecular weight of 433.05 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)propyl]-1-(7-methylsulfanylthieno[3,2-d]pyrimidin-4-yl)piperidin-4-amine.
| Compound Name | N-[3-(3-chlorophenyl)propyl]-1-(7-methylsulfanylthieno[3,2-d]pyrimidin-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 175315760 |
| Molecular Formula | C21H25ClN4S2 |
| Molecular Weight | 433.05 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[3-(3-chlorophenyl)propyl]-1-(7-methylsulfanylthieno[3,2-d]pyrimidin-4-yl)piperidin-4-amine |
| SMILES | CSc1csc2c(N3CCC(NCCCc4cccc(Cl)c4)CC3)ncnc12 |
| InChI | InChI=1S/C21H25ClN4S2/c1-27-18-13-28-20-19(18)24-14-25-21(20)26-10-7-17(8-11-26)23-9-3-5-15-4-2-6-16(22)12-15/h2,4,6,12-14,17,23H,3,5,7-11H2,1H3 |
| InChIKey | QPETVIMTSFTLJZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.05 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|