C14H17N3O — CID 156539300
2-(2,4-diamino-6-phenylanilino)ethanol (PubChem CID 156539300) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-(2,4-diamino-6-phenylanilino)ethanol.
| Compound Name | 2-(2,4-diamino-6-phenylanilino)ethanol |
|---|---|
| PubChem CID | 156539300 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-(2,4-diamino-6-phenylanilino)ethanol |
| SMILES | Nc1cc(N)c(NCCO)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H17N3O/c15-11-8-12(10-4-2-1-3-5-10)14(13(16)9-11)17-6-7-18/h1-5,8-9,17-18H,6-7,15-16H2 |
| InChIKey | XCBJCNQFELXTCT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|