C11H8BrF3N4O2 — CID 156540118
11-bromo-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid (PubChem CID 156540118) has the molecular formula C11H8BrF3N4O2 and a molecular weight of 365.11 g/mol. Its IUPAC name is 11-bromo-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid.
| Compound Name | 11-bromo-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid |
|---|---|
| PubChem CID | 156540118 |
| Molecular Formula | C11H8BrF3N4O2 |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 11-bromo-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid |
| SMILES | CC1(C(F)(F)F)CN(C(=O)O)c2cnc3cc(Br)nn3c21 |
| InChI | InChI=1S/C11H8BrF3N4O2/c1-10(11(13,14)15)4-18(9(20)21)5-3-16-7-2-6(12)17-19(7)8(5)10/h2-3H,4H2,1H3,(H,20,21) |
| InChIKey | FWEYAPQDBFMBEZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |