C10H25N5 — CID 156540184
N'-[2-(1-piperazin-2-ylethylamino)ethyl]ethane-1,2-diamine (PubChem CID 156540184) has the molecular formula C10H25N5 and a molecular weight of 215.34 g/mol. Its IUPAC name is N'-[2-(1-piperazin-2-ylethylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(1-piperazin-2-ylethylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 156540184 |
| Molecular Formula | C10H25N5 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.21 |
| IUPAC Name | N'-[2-(1-piperazin-2-ylethylamino)ethyl]ethane-1,2-diamine |
| SMILES | CC(NCCNCCN)C1CNCCN1 |
| InChI | InChI=1S/C10H25N5/c1-9(10-8-13-5-7-15-10)14-6-4-12-3-2-11/h9-10,12-15H,2-8,11H2,1H3 |
| InChIKey | DSPDOVLFKOVPAM-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|