C15H14F3N5O2 — CID 156541976
1-[(1E,3E)-4-hydroxy-1-(methylideneamino)penta-1,3-dien-2-yl]-4-(methylamino)-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 156541976) has the molecular formula C15H14F3N5O2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 1-[(1E,3E)-4-hydroxy-1-(methylideneamino)penta-1,3-dien-2-yl]-4-(methylamino)-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 1-[(1E,3E)-4-hydroxy-1-(methylideneamino)penta-1,3-dien-2-yl]-4-(methylamino)-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 156541976 |
| Molecular Formula | C15H14F3N5O2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 1-[(1E,3E)-4-hydroxy-1-(methylideneamino)penta-1,3-dien-2-yl]-4-(methylamino)-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | C=N/C=C(\C=C(/C)O)n1c(=O)nc(NC)c2ccc(C(F)(F)F)nc21 |
| InChI | InChI=1S/C15H14F3N5O2/c1-8(24)6-9(7-19-2)23-13-10(12(20-3)22-14(23)25)4-5-11(21-13)15(16,17)18/h4-7,24H,2H2,1,3H3,(H,20,22,25)/b8-6+,9-7+ |
| InChIKey | PHMUYLCRCWQXLM-CDJQDVQCSA-N |
| XLogP | 2.81 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|