C23H20ClN5OS — CID 156544056
[2-[4-[[2-(3-chlorophenyl)-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]phenyl]-3-oxopropyl]cyanamide (PubChem CID 156544056) has the molecular formula C23H20ClN5OS and a molecular weight of 449.97 g/mol. Its IUPAC name is [2-[4-[[2-(3-chlorophenyl)-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]phenyl]-3-oxopropyl]cyanamide.
| Compound Name | [2-[4-[[2-(3-chlorophenyl)-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]phenyl]-3-oxopropyl]cyanamide |
|---|---|
| PubChem CID | 156544056 |
| Molecular Formula | C23H20ClN5OS |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [2-[4-[[2-(3-chlorophenyl)-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]phenyl]-3-oxopropyl]cyanamide |
| SMILES | N#CNCC(C=O)c1ccc(Nc2nc(-c3cccc(Cl)c3)nc3c2SCCC3)cc1 |
| InChI | InChI=1S/C23H20ClN5OS/c24-18-4-1-3-16(11-18)22-28-20-5-2-10-31-21(20)23(29-22)27-19-8-6-15(7-9-19)17(13-30)12-26-14-25/h1,3-4,6-9,11,13,17,26H,2,5,10,12H2,(H,27,28,29) |
| InChIKey | VJATUBBEJOMQAS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|