C19H16N6S — CID 89112562
2-(3-aminophenyl)-N-(1H-indazol-5-yl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine (PubChem CID 89112562) has the molecular formula C19H16N6S and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-(1H-indazol-5-yl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-(3-aminophenyl)-N-(1H-indazol-5-yl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 89112562 |
| Molecular Formula | C19H16N6S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-(3-aminophenyl)-N-(1H-indazol-5-yl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
| SMILES | Nc1cccc(-c2nc3c(c(Nc4ccc5[nH]ncc5c4)n2)SCC3)c1 |
| InChI | InChI=1S/C19H16N6S/c20-13-3-1-2-11(8-13)18-23-16-6-7-26-17(16)19(24-18)22-14-4-5-15-12(9-14)10-21-25-15/h1-5,8-10H,6-7,20H2,(H,21,25)(H,22,23,24) |
| InChIKey | YWZGFYQTRWYBFE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|