C24H24F3IN4O — CID 156548227
4-[[1-iodo-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]amino]-2,6,6,8-tetramethylpyrrolo[3,2-g]quinazolin-7-one (PubChem CID 156548227) has the molecular formula C24H24F3IN4O and a molecular weight of 568.38 g/mol. Its IUPAC name is 4-[[1-iodo-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]amino]-2,6,6,8-tetramethylpyrrolo[3,2-g]quinazolin-7-one.
| Compound Name | 4-[[1-iodo-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]amino]-2,6,6,8-tetramethylpyrrolo[3,2-g]quinazolin-7-one |
|---|---|
| PubChem CID | 156548227 |
| Molecular Formula | C24H24F3IN4O |
| Molecular Weight | 568.38 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 4-[[1-iodo-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]amino]-2,6,6,8-tetramethylpyrrolo[3,2-g]quinazolin-7-one |
| SMILES | Cc1nc(NC(C)(I)c2cccc(C(F)(F)F)c2C)c2cc3c(cc2n1)N(C)C(=O)C3(C)C |
| InChI | InChI=1S/C24H24F3IN4O/c1-12-15(8-7-9-16(12)24(25,26)27)23(5,28)31-20-14-10-17-19(11-18(14)29-13(2)30-20)32(6)21(33)22(17,3)4/h7-11H,1-6H3,(H,29,30,31) |
| InChIKey | ZLVPJERGAWBPAY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.38 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|