C20H19F2NO2S — CID 156548587
ethyl 2-[(3,3-dimethyl-2-sulfanylideneindol-1-yl)methyl]-3,4-difluorobenzoate (PubChem CID 156548587) has the molecular formula C20H19F2NO2S and a molecular weight of 375.44 g/mol. Its IUPAC name is ethyl 2-[(3,3-dimethyl-2-sulfanylideneindol-1-yl)methyl]-3,4-difluorobenzoate.
| Compound Name | ethyl 2-[(3,3-dimethyl-2-sulfanylideneindol-1-yl)methyl]-3,4-difluorobenzoate |
|---|---|
| PubChem CID | 156548587 |
| Molecular Formula | C20H19F2NO2S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl 2-[(3,3-dimethyl-2-sulfanylideneindol-1-yl)methyl]-3,4-difluorobenzoate |
| SMILES | CCOC(=O)c1ccc(F)c(F)c1CN1C(=S)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H19F2NO2S/c1-4-25-18(24)12-9-10-15(21)17(22)13(12)11-23-16-8-6-5-7-14(16)20(2,3)19(23)26/h5-10H,4,11H2,1-3H3 |
| InChIKey | DGSFUCLGYTYWET-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|