C17H13F3N2O2 — CID 156549064
3-cyano-N-methyl-4-[[3-(trifluoromethyl)phenyl]methoxy]benzamide (PubChem CID 156549064) has the molecular formula C17H13F3N2O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is 3-cyano-N-methyl-4-[[3-(trifluoromethyl)phenyl]methoxy]benzamide.
| Compound Name | 3-cyano-N-methyl-4-[[3-(trifluoromethyl)phenyl]methoxy]benzamide |
|---|---|
| PubChem CID | 156549064 |
| Molecular Formula | C17H13F3N2O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-cyano-N-methyl-4-[[3-(trifluoromethyl)phenyl]methoxy]benzamide |
| SMILES | CNC(=O)c1ccc(OCc2cccc(C(F)(F)F)c2)c(C#N)c1 |
| InChI | InChI=1S/C17H13F3N2O2/c1-22-16(23)12-5-6-15(13(8-12)9-21)24-10-11-3-2-4-14(7-11)17(18,19)20/h2-8H,10H2,1H3,(H,22,23) |
| InChIKey | NFGRAGLZPCHSQI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |