C10H15FN4O2 — CID 156550393
(3S,4R,5R)-1-(4-aminopyrimidin-2-yl)-3-fluoro-5-methoxypiperidin-4-ol (PubChem CID 156550393) has the molecular formula C10H15FN4O2 and a molecular weight of 242.25 g/mol. Its IUPAC name is (3S,4R,5R)-1-(4-aminopyrimidin-2-yl)-3-fluoro-5-methoxypiperidin-4-ol.
| Compound Name | (3S,4R,5R)-1-(4-aminopyrimidin-2-yl)-3-fluoro-5-methoxypiperidin-4-ol |
|---|---|
| PubChem CID | 156550393 |
| Molecular Formula | C10H15FN4O2 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (3S,4R,5R)-1-(4-aminopyrimidin-2-yl)-3-fluoro-5-methoxypiperidin-4-ol |
| SMILES | CO[C@@H]1CN(c2nccc(N)n2)C[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C10H15FN4O2/c1-17-7-5-15(4-6(11)9(7)16)10-13-3-2-8(12)14-10/h2-3,6-7,9,16H,4-5H2,1H3,(H2,12,13,14)/t6-,7+,9-/m0/s1 |
| InChIKey | UKMLQPAJZRAEPD-OOZYFLPDSA-N |
| XLogP | -0.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |