C17H33N3S — CID 156551163
5-tert-butyl-2-[[1-(1-methylsulfanylethyl)azetidin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 156551163) has the molecular formula C17H33N3S and a molecular weight of 311.54 g/mol. Its IUPAC name is 5-tert-butyl-2-[[1-(1-methylsulfanylethyl)azetidin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-tert-butyl-2-[[1-(1-methylsulfanylethyl)azetidin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 156551163 |
| Molecular Formula | C17H33N3S |
| Molecular Weight | 311.54 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 5-tert-butyl-2-[[1-(1-methylsulfanylethyl)azetidin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CSC(C)N1CC(CN2CC3CN(C(C)(C)C)CC3C2)C1 |
| InChI | InChI=1S/C17H33N3S/c1-13(21-5)19-7-14(8-19)6-18-9-15-11-20(17(2,3)4)12-16(15)10-18/h13-16H,6-12H2,1-5H3 |
| InChIKey | CSLLWADGUBYZKK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |