C18H15BrN2O6 — CID 15655661
(4S)-3-[(2R,3S)-2-bromo-3-hydroxy-3-(4-nitrophenyl)propanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 15655661) has the molecular formula C18H15BrN2O6 and a molecular weight of 435.23 g/mol. Its IUPAC name is (4S)-3-[(2R,3S)-2-bromo-3-hydroxy-3-(4-nitrophenyl)propanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R,3S)-2-bromo-3-hydroxy-3-(4-nitrophenyl)propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15655661 |
| Molecular Formula | C18H15BrN2O6 |
| Molecular Weight | 435.23 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | (4S)-3-[(2R,3S)-2-bromo-3-hydroxy-3-(4-nitrophenyl)propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N1C(=O)[C@H](Br)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15BrN2O6/c19-15(16(22)12-6-8-13(9-7-12)21(25)26)17(23)20-14(10-27-18(20)24)11-4-2-1-3-5-11/h1-9,14-16,22H,10H2/t14-,15-,16+/m1/s1 |
| InChIKey | BIGIMFJZBINUPX-OAGGEKHMSA-N |
| XLogP | 3.11 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|