C20H17F3N2O5S — CID 101408922
(2S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3,3,3-trifluoro-2-[(R)-hydroxy-(4-nitrophenyl)methyl]propan-1-one (PubChem CID 101408922) has the molecular formula C20H17F3N2O5S and a molecular weight of 454.43 g/mol. Its IUPAC name is (2S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3,3,3-trifluoro-2-[(R)-hydroxy-(4-nitrophenyl)methyl]propan-1-one.
| Compound Name | (2S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3,3,3-trifluoro-2-[(R)-hydroxy-(4-nitrophenyl)methyl]propan-1-one |
|---|---|
| PubChem CID | 101408922 |
| Molecular Formula | C20H17F3N2O5S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (2S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3,3,3-trifluoro-2-[(R)-hydroxy-(4-nitrophenyl)methyl]propan-1-one |
| SMILES | O=C([C@H]([C@@H](O)c1ccc([N+](=O)[O-])cc1)C(F)(F)F)N1C(=S)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H17F3N2O5S/c21-20(22,23)16(17(26)13-6-8-14(9-7-13)25(28)29)18(27)24-15(11-30-19(24)31)10-12-4-2-1-3-5-12/h1-9,15-17,26H,10-11H2/t15-,16-,17-/m0/s1 |
| InChIKey | VVWTYLJQPCXLQK-ULQDDVLXSA-N |
| XLogP | 3.56 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|