C29H30N2O6 — CID 16726977
(4S)-3-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)butanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 16726977) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is (4S)-3-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)butanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)butanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 16726977 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (4S)-3-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)butanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H]1N(C(=O)[C@H](C)[C@@](C)(O)c2ccc([N+](=O)[O-])cc2)C(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H30N2O6/c1-19(2)25-29(22-11-7-5-8-12-22,23-13-9-6-10-14-23)37-27(33)30(25)26(32)20(3)28(4,34)21-15-17-24(18-16-21)31(35)36/h5-20,25,34H,1-4H3/t20-,25-,28+/m0/s1 |
| InChIKey | YOOZJKQGNUGZDE-OOYKWLJTSA-N |
| XLogP | 5.39 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|