C21H23N3O5 — CID 15101899
(4S,5R)-1-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-3,4-dimethyl-5-phenylimidazolidin-2-one (PubChem CID 15101899) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is (4S,5R)-1-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-3,4-dimethyl-5-phenylimidazolidin-2-one.
| Compound Name | (4S,5R)-1-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 15101899 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (4S,5R)-1-[(2R,3R)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)N(C)[C@@H](C)[C@H]1c1ccccc1)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H23N3O5/c1-13(19(25)16-9-11-17(12-10-16)24(28)29)20(26)23-18(14(2)22(3)21(23)27)15-7-5-4-6-8-15/h4-14,18-19,25H,1-3H3/t13-,14+,18+,19-/m1/s1 |
| InChIKey | KODCUPOPTWFPLY-SPLQCWDRSA-N |
| XLogP | 3.29 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|