C14H18N2O4 — CID 156561074
N-[3-(3-hydroxyoxetan-3-yl)-5-morpholin-4-ylphenyl]formamide (PubChem CID 156561074) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-[3-(3-hydroxyoxetan-3-yl)-5-morpholin-4-ylphenyl]formamide.
| Compound Name | N-[3-(3-hydroxyoxetan-3-yl)-5-morpholin-4-ylphenyl]formamide |
|---|---|
| PubChem CID | 156561074 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[3-(3-hydroxyoxetan-3-yl)-5-morpholin-4-ylphenyl]formamide |
| SMILES | O=CNc1cc(N2CCOCC2)cc(C2(O)COC2)c1 |
| InChI | InChI=1S/C14H18N2O4/c17-10-15-12-5-11(14(18)8-20-9-14)6-13(7-12)16-1-3-19-4-2-16/h5-7,10,18H,1-4,8-9H2,(H,15,17) |
| InChIKey | LCJDNBYMHXSFPS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|