C25H35BrN2O4 — CID 156562120
tert-butyl 5-[1-[[(E)-3-(2-bromophenyl)-4-methoxy-4-oxobut-2-en-2-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 156562120) has the molecular formula C25H35BrN2O4 and a molecular weight of 507.47 g/mol. Its IUPAC name is tert-butyl 5-[1-[[(E)-3-(2-bromophenyl)-4-methoxy-4-oxobut-2-en-2-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 5-[1-[[(E)-3-(2-bromophenyl)-4-methoxy-4-oxobut-2-en-2-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 156562120 |
| Molecular Formula | C25H35BrN2O4 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | tert-butyl 5-[1-[[(E)-3-(2-bromophenyl)-4-methoxy-4-oxobut-2-en-2-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | COC(=O)/C(=C(\C)NC(C)C1CC2CN(C(=O)OC(C)(C)C)CC2C1)c1ccccc1Br |
| InChI | InChI=1S/C25H35BrN2O4/c1-15(27-16(2)22(23(29)31-6)20-9-7-8-10-21(20)26)17-11-18-13-28(14-19(18)12-17)24(30)32-25(3,4)5/h7-10,15,17-19,27H,11-14H2,1-6H3/b22-16+ |
| InChIKey | ZGESPXWDSWHGHY-CJLVFECKSA-N |
| XLogP | 5.22 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|