C16H12N4O — CID 156562186
2-(1-amino-5H-pyridazino[4,5-b]indol-4-yl)phenol (PubChem CID 156562186) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-(1-amino-5H-pyridazino[4,5-b]indol-4-yl)phenol.
| Compound Name | 2-(1-amino-5H-pyridazino[4,5-b]indol-4-yl)phenol |
|---|---|
| PubChem CID | 156562186 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(1-amino-5H-pyridazino[4,5-b]indol-4-yl)phenol |
| SMILES | Nc1nnc(-c2ccccc2O)c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C16H12N4O/c17-16-13-9-5-1-3-7-11(9)18-15(13)14(19-20-16)10-6-2-4-8-12(10)21/h1-8,18,21H,(H2,17,20) |
| InChIKey | AINWTFKYNIXGCU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |