C5H10FNO3 — CID 156564830
(3R,4R,5S)-4-amino-3-fluoro-5-(hydroxymethyl)oxolan-2-ol (PubChem CID 156564830) has the molecular formula C5H10FNO3 and a molecular weight of 151.14 g/mol. Its IUPAC name is (3R,4R,5S)-4-amino-3-fluoro-5-(hydroxymethyl)oxolan-2-ol.
| Compound Name | (3R,4R,5S)-4-amino-3-fluoro-5-(hydroxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 156564830 |
| Molecular Formula | C5H10FNO3 |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (3R,4R,5S)-4-amino-3-fluoro-5-(hydroxymethyl)oxolan-2-ol |
| SMILES | N[C@@H]1[C@@H](CO)OC(O)[C@@H]1F |
| InChI | InChI=1S/C5H10FNO3/c6-3-4(7)2(1-8)10-5(3)9/h2-5,8-9H,1,7H2/t2-,3-,4-,5?/m1/s1 |
| InChIKey | DEGZUGSJXIRHKR-SOOFDHNKSA-N |
| XLogP | -1.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |