C6H9F3O3 — CID 130763832
(2S,3S,4S,5R,6R)-3,4,5-trifluoro-6-(hydroxymethyl)oxan-2-ol (PubChem CID 130763832) has the molecular formula C6H9F3O3 and a molecular weight of 186.13 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-trifluoro-6-(hydroxymethyl)oxan-2-ol.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-trifluoro-6-(hydroxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 130763832 |
| Molecular Formula | C6H9F3O3 |
| Molecular Weight | 186.13 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-trifluoro-6-(hydroxymethyl)oxan-2-ol |
| SMILES | OC[C@H]1O[C@H](O)[C@H](F)[C@@H](F)[C@@H]1F |
| InChI | InChI=1S/C6H9F3O3/c7-3-2(1-10)12-6(11)5(9)4(3)8/h2-6,10-11H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | NNCFKUYZXHKZEC-DVKNGEFBSA-N |
| XLogP | -0.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |