C15H27NO5 — CID 156565796
[(1S,3S)-3-(hydroxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] propanoate (PubChem CID 156565796) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is [(1S,3S)-3-(hydroxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] propanoate.
| Compound Name | [(1S,3S)-3-(hydroxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] propanoate |
|---|---|
| PubChem CID | 156565796 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | [(1S,3S)-3-(hydroxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] propanoate |
| SMILES | CCC(=O)O[C@@]1(NC(=O)OC(C)(C)C)CCC[C@H](CO)C1 |
| InChI | InChI=1S/C15H27NO5/c1-5-12(18)20-15(8-6-7-11(9-15)10-17)16-13(19)21-14(2,3)4/h11,17H,5-10H2,1-4H3,(H,16,19)/t11-,15-/m0/s1 |
| InChIKey | MTFIVQIZGBOXFD-NHYWBVRUSA-N |
| XLogP | 2.34 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|