C27H23ClN2O3 — CID 156568807
(3R)-3-[2-(3-chlorophenyl)-2-oxoethyl]-3-hydroxy-1-[3-(1H-indol-3-yl)propyl]indol-2-one (PubChem CID 156568807) has the molecular formula C27H23ClN2O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is (3R)-3-[2-(3-chlorophenyl)-2-oxoethyl]-3-hydroxy-1-[3-(1H-indol-3-yl)propyl]indol-2-one.
| Compound Name | (3R)-3-[2-(3-chlorophenyl)-2-oxoethyl]-3-hydroxy-1-[3-(1H-indol-3-yl)propyl]indol-2-one |
|---|---|
| PubChem CID | 156568807 |
| Molecular Formula | C27H23ClN2O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (3R)-3-[2-(3-chlorophenyl)-2-oxoethyl]-3-hydroxy-1-[3-(1H-indol-3-yl)propyl]indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)N(CCCc2c[nH]c3ccccc23)c2ccccc21)c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H23ClN2O3/c28-20-9-5-7-18(15-20)25(31)16-27(33)22-11-2-4-13-24(22)30(26(27)32)14-6-8-19-17-29-23-12-3-1-10-21(19)23/h1-5,7,9-13,15,17,29,33H,6,8,14,16H2/t27-/m1/s1 |
| InChIKey | ZYEBBGRVFZZXLS-HHHXNRCGSA-N |
| XLogP | 5.26 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |